C15H26O5Si — CID 50993174
methyl 2-[(2S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2H-pyran-6-yl]acetate (PubChem CID 50993174) has the molecular formula C15H26O5Si and a molecular weight of 314.45 g/mol. Its IUPAC name is methyl 2-[(2S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2H-pyran-6-yl]acetate.
| Compound Name | methyl 2-[(2S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 50993174 |
| Molecular Formula | C15H26O5Si |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | methyl 2-[(2S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2H-pyran-6-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)C=CC1=O |
| InChI | InChI=1S/C15H26O5Si/c1-15(2,3)21(5,6)19-10-11-7-8-12(16)13(20-11)9-14(17)18-4/h7-8,11,13H,9-10H2,1-6H3/t11-,13-/m0/s1 |
| InChIKey | YVYHMOMXHYGCPU-AAEUAGOBSA-N |
| XLogP | 2.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|