C19H36O5Si — CID 91195546
(4S)-4-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-one;tert-butyl 2-methoxyacetate (PubChem CID 91195546) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-one;tert-butyl 2-methoxyacetate.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-one;tert-butyl 2-methoxyacetate |
|---|---|
| PubChem CID | 91195546 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-one;tert-butyl 2-methoxyacetate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=CC(=O)CC1.COCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22O2Si.C7H14O3/c1-12(2,3)15(4,5)14-11-8-6-10(13)7-9-11;1-7(2,3)10-6(8)5-9-4/h6,8,11H,7,9H2,1-5H3;5H2,1-4H3/t11-;/m1./s1 |
| InChIKey | RSPTZPCWELCXJG-RFVHGSKJSA-N |
| XLogP | 4.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|