C25H46O5Si — CID 11178539
tert-butyl (2E,5S,6R)-5-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoyl]oxy-6-methylocta-2,7-dienoate (PubChem CID 11178539) has the molecular formula C25H46O5Si and a molecular weight of 454.72 g/mol. Its IUPAC name is tert-butyl (2E,5S,6R)-5-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoyl]oxy-6-methylocta-2,7-dienoate.
| Compound Name | tert-butyl (2E,5S,6R)-5-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoyl]oxy-6-methylocta-2,7-dienoate |
|---|---|
| PubChem CID | 11178539 |
| Molecular Formula | C25H46O5Si |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | tert-butyl (2E,5S,6R)-5-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoyl]oxy-6-methylocta-2,7-dienoate |
| SMILES | C=C[C@@H](C)[C@H](C/C=C/C(=O)OC(C)(C)C)OC(=O)[C@H](CC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46O5Si/c1-13-19(4)20(15-14-16-22(26)29-24(5,6)7)28-23(27)21(17-18(2)3)30-31(11,12)25(8,9)10/h13-14,16,18-21H,1,15,17H2,2-12H3/b16-14+/t19-,20+,21+/m1/s1 |
| InChIKey | QWXNJLYITVULEN-AMWLHTGXSA-N |
| XLogP | 6.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|