C23H31ClO3 — CID 10960128
(1S,4S,5R,8S,9R,12R,13R)-9-[3-(3-chlorophenyl)propyl]-1,5-dimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane (PubChem CID 10960128) has the molecular formula C23H31ClO3 and a molecular weight of 390.95 g/mol. Its IUPAC name is (1S,4S,5R,8S,9R,12R,13R)-9-[3-(3-chlorophenyl)propyl]-1,5-dimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane.
| Compound Name | (1S,4S,5R,8S,9R,12R,13R)-9-[3-(3-chlorophenyl)propyl]-1,5-dimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane |
|---|---|
| PubChem CID | 10960128 |
| Molecular Formula | C23H31ClO3 |
| Molecular Weight | 390.95 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (1S,4S,5R,8S,9R,12R,13R)-9-[3-(3-chlorophenyl)propyl]-1,5-dimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](CCCc3cccc(Cl)c3)CO[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32O4 |
| InChI | InChI=1S/C23H31ClO3/c1-15-9-10-20-17(7-3-5-16-6-4-8-18(24)13-16)14-25-21-23(20)19(15)11-12-22(2,26-21)27-23/h4,6,8,13,15,17,19-21H,3,5,7,9-12,14H2,1-2H3/t15-,17+,19+,20+,21-,22-,23-/m1/s1 |
| InChIKey | KMWYPATVLFEZIA-YEMUDNHFSA-N |
| XLogP | 5.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.95 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |