C30H42N4O8 — CID 10962976
cyclohexyl 2-[(2S)-7-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3,8,10-trioxo-1,4,7-triazecan-2-yl]acetate (PubChem CID 10962976) has the molecular formula C30H42N4O8 and a molecular weight of 586.69 g/mol. Its IUPAC name is cyclohexyl 2-[(2S)-7-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3,8,10-trioxo-1,4,7-triazecan-2-yl]acetate.
| Compound Name | cyclohexyl 2-[(2S)-7-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3,8,10-trioxo-1,4,7-triazecan-2-yl]acetate |
|---|---|
| PubChem CID | 10962976 |
| Molecular Formula | C30H42N4O8 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | cyclohexyl 2-[(2S)-7-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3,8,10-trioxo-1,4,7-triazecan-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN([C@@H](Cc2ccccc2)C(N)=O)C(=O)CC(=O)N[C@@H](CC(=O)OC2CCCCC2)C1=O |
| InChI | InChI=1S/C30H42N4O8/c1-30(2,3)42-27(38)19-33-14-15-34(23(28(31)39)16-20-10-6-4-7-11-20)25(36)18-24(35)32-22(29(33)40)17-26(37)41-21-12-8-5-9-13-21/h4,6-7,10-11,21-23H,5,8-9,12-19H2,1-3H3,(H2,31,39)(H,32,35)/t22-,23-/m0/s1 |
| InChIKey | BAQVKPAJIGICHM-GOTSBHOMSA-N |
| XLogP | 1.24 |
| TPSA | 165.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|