C36H20F8 — CID 10963069
(6S,13R,20R,27S)-2,2,3,3,16,16,17,17-octafluorononacyclo[16.10.2.24,15.26,13.220,27.05,14.07,12.019,28.021,26]hexatriaconta-1(28),4,7,9,11,14,18,21,23,25,29,31,33,35-tetradecaene (PubChem CID 10963069) has the molecular formula C36H20F8 and a molecular weight of 604.54 g/mol. Its IUPAC name is (6S,13R,20R,27S)-2,2,3,3,16,16,17,17-octafluorononacyclo[16.10.2.24,15.26,13.220,27.05,14.07,12.019,28.021,26]hexatriaconta-1(28),4,7,9,11,14,18,21,23,25,29,31,33,35-tetradecaene.
| Compound Name | (6S,13R,20R,27S)-2,2,3,3,16,16,17,17-octafluorononacyclo[16.10.2.24,15.26,13.220,27.05,14.07,12.019,28.021,26]hexatriaconta-1(28),4,7,9,11,14,18,21,23,25,29,31,33,35-tetradecaene |
|---|---|
| PubChem CID | 10963069 |
| Molecular Formula | C36H20F8 |
| Molecular Weight | 604.54 g/mol |
| Exact Mass | 604.14 |
| IUPAC Name | (6S,13R,20R,27S)-2,2,3,3,16,16,17,17-octafluorononacyclo[16.10.2.24,15.26,13.220,27.05,14.07,12.019,28.021,26]hexatriaconta-1(28),4,7,9,11,14,18,21,23,25,29,31,33,35-tetradecaene |
| SMILES | FC1(F)c2ccc(c3c2[C@@H]2C=C[C@H]3c3ccccc32)C(F)(F)C(F)(F)c2ccc(c3c2[C@H]2C=C[C@@H]3c3ccccc32)C1(F)F |
| InChI | InChI=1S/C36H20F8/c37-33(38)25-13-14-26(30-22-10-9-21(29(25)30)17-5-1-2-6-18(17)22)34(39,40)36(43,44)28-16-15-27(35(33,41)42)31-23-11-12-24(32(28)31)20-8-4-3-7-19(20)23/h1-16,21-24H/t21-,22+,23-,24+ |
| InChIKey | MDNNOHCODUZIQC-WAPCQROESA-N |
| XLogP | 10.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.54 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|