C11H17NO4 — CID 10966225
(3R,7aR)-3-tert-butyl-7a-(hydroxymethyl)-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-5,7-dione (PubChem CID 10966225) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (3R,7aR)-3-tert-butyl-7a-(hydroxymethyl)-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-5,7-dione.
| Compound Name | (3R,7aR)-3-tert-butyl-7a-(hydroxymethyl)-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-5,7-dione |
|---|---|
| PubChem CID | 10966225 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (3R,7aR)-3-tert-butyl-7a-(hydroxymethyl)-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-5,7-dione |
| SMILES | CC(C)(C)[C@H]1OC[C@]2(CO)C(=O)CC(=O)N12 |
| InChI | InChI=1S/C11H17NO4/c1-10(2,3)9-12-8(15)4-7(14)11(12,5-13)6-16-9/h9,13H,4-6H2,1-3H3/t9-,11-/m1/s1 |
| InChIKey | MWFBWRDYEKLECU-MWLCHTKSSA-N |
| XLogP | -0.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|