C16H28O2Si — CID 10967929
[(1E,3E)-1-(3,4-dihydro-2H-pyran-6-yl)-1-methoxyhepta-1,3-dien-3-yl]-trimethylsilane (PubChem CID 10967929) has the molecular formula C16H28O2Si and a molecular weight of 280.48 g/mol. Its IUPAC name is [(1E,3E)-1-(3,4-dihydro-2H-pyran-6-yl)-1-methoxyhepta-1,3-dien-3-yl]-trimethylsilane.
| Compound Name | [(1E,3E)-1-(3,4-dihydro-2H-pyran-6-yl)-1-methoxyhepta-1,3-dien-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 10967929 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | [(1E,3E)-1-(3,4-dihydro-2H-pyran-6-yl)-1-methoxyhepta-1,3-dien-3-yl]-trimethylsilane |
| SMILES | CCC/C=C(\C=C(\OC)C1=CCCCO1)[Si](C)(C)C |
| InChI | InChI=1S/C16H28O2Si/c1-6-7-10-14(19(3,4)5)13-16(17-2)15-11-8-9-12-18-15/h10-11,13H,6-9,12H2,1-5H3/b14-10+,16-13+ |
| InChIKey | BCOLTHUUVWORBK-GOAZRFPBSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|