C13H16O5S — CID 10968045
(4R)-4-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10968045) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is (4R)-4-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10968045 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (4R)-4-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@H]([C@H]2O[C@@H]2S(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C13H16O5S/c1-13(2)16-8-10(18-13)11-12(17-11)19(14,15)9-6-4-3-5-7-9/h3-7,10-12H,8H2,1-2H3/t10-,11-,12-/m1/s1 |
| InChIKey | UBNWRESEKPMHFZ-IJLUTSLNSA-N |
| XLogP | 1.34 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|