C16H22ClNO2S — CID 10969499
methyl 2-[(2-amino-5-chlorophenyl)-cyclohexylmethyl]sulfanylacetate (PubChem CID 10969499) has the molecular formula C16H22ClNO2S and a molecular weight of 327.88 g/mol. Its IUPAC name is methyl 2-[(2-amino-5-chlorophenyl)-cyclohexylmethyl]sulfanylacetate.
| Compound Name | methyl 2-[(2-amino-5-chlorophenyl)-cyclohexylmethyl]sulfanylacetate |
|---|---|
| PubChem CID | 10969499 |
| Molecular Formula | C16H22ClNO2S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | methyl 2-[(2-amino-5-chlorophenyl)-cyclohexylmethyl]sulfanylacetate |
| SMILES | COC(=O)CSC(c1cc(Cl)ccc1N)C1CCCCC1 |
| InChI | InChI=1S/C16H22ClNO2S/c1-20-15(19)10-21-16(11-5-3-2-4-6-11)13-9-12(17)7-8-14(13)18/h7-9,11,16H,2-6,10,18H2,1H3 |
| InChIKey | KGPZXQKMBUKNSW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|