C21H42O4Si2 — CID 10971728
(2S)-4-[(3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-2-methyl-2H-furan-5-one (PubChem CID 10971728) has the molecular formula C21H42O4Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is (2S)-4-[(3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[(3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 10971728 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | (2S)-4-[(3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-2-methyl-2H-furan-5-one |
| SMILES | C[C@H]1C=C(CC[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C21H42O4Si2/c1-16-14-17(19(22)24-16)12-13-18(25-27(10,11)21(5,6)7)15-23-26(8,9)20(2,3)4/h14,16,18H,12-13,15H2,1-11H3/t16-,18+/m0/s1 |
| InChIKey | LRNYPKBFSKBEKT-FUHWJXTLSA-N |
| XLogP | 6.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|