C26H48O6Si2 — CID 154708344
[(E,2R,3S,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(2S)-5-oxooxolan-2-yl]hex-4-en-3-yl] (E)-but-2-enoate (PubChem CID 154708344) has the molecular formula C26H48O6Si2 and a molecular weight of 512.84 g/mol. Its IUPAC name is [(E,2R,3S,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(2S)-5-oxooxolan-2-yl]hex-4-en-3-yl] (E)-but-2-enoate.
| Compound Name | [(E,2R,3S,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(2S)-5-oxooxolan-2-yl]hex-4-en-3-yl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 154708344 |
| Molecular Formula | C26H48O6Si2 |
| Molecular Weight | 512.84 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | [(E,2R,3S,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(2S)-5-oxooxolan-2-yl]hex-4-en-3-yl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OC(/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCC(=O)O1)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O6Si2/c1-13-14-23(27)29-20(19(2)31-33(9,10)25(3,4)5)15-16-22(21-17-18-24(28)30-21)32-34(11,12)26(6,7)8/h13-16,19-22H,17-18H2,1-12H3/b14-13+,16-15+/t19-,20?,21+,22-/m1/s1 |
| InChIKey | NQRLDDGCKYRWHT-DVYACNEZSA-N |
| XLogP | 6.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.84 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|