C20H34O6Si — CID 154709333
[(E,2R,3S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-6-[(2S)-5-oxooxolan-2-yl]hex-4-en-3-yl] (E)-but-2-enoate (PubChem CID 154709333) has the molecular formula C20H34O6Si and a molecular weight of 398.57 g/mol. Its IUPAC name is [(E,2R,3S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-6-[(2S)-5-oxooxolan-2-yl]hex-4-en-3-yl] (E)-but-2-enoate.
| Compound Name | [(E,2R,3S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-6-[(2S)-5-oxooxolan-2-yl]hex-4-en-3-yl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 154709333 |
| Molecular Formula | C20H34O6Si |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | [(E,2R,3S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-6-[(2S)-5-oxooxolan-2-yl]hex-4-en-3-yl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@@H](/C=C/[C@@H](O)[C@@H]1CCC(=O)O1)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O6Si/c1-8-9-18(22)24-16(14(2)26-27(6,7)20(3,4)5)11-10-15(21)17-12-13-19(23)25-17/h8-11,14-17,21H,12-13H2,1-7H3/b9-8+,11-10+/t14-,15-,16+,17+/m1/s1 |
| InChIKey | OQQCXQDKSXPLAQ-WLZFDDBPSA-N |
| XLogP | 3.51 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|