C16H28O3Si — CID 162466811
(5R)-5-[(1S,2E,4E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-2,4-dienyl]oxolan-2-one (PubChem CID 162466811) has the molecular formula C16H28O3Si and a molecular weight of 296.48 g/mol. Its IUPAC name is (5R)-5-[(1S,2E,4E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-2,4-dienyl]oxolan-2-one.
| Compound Name | (5R)-5-[(1S,2E,4E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-2,4-dienyl]oxolan-2-one |
|---|---|
| PubChem CID | 162466811 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (5R)-5-[(1S,2E,4E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-2,4-dienyl]oxolan-2-one |
| SMILES | C/C=C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C16H28O3Si/c1-7-8-9-10-14(13-11-12-15(17)18-13)19-20(5,6)16(2,3)4/h7-10,13-14H,11-12H2,1-6H3/b8-7+,10-9+/t13-,14+/m1/s1 |
| InChIKey | NKUBWZVATFFHNH-OTEOONLJSA-N |
| XLogP | 4.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|