C25H46O6Si — CID 141075945
(E)-3-(5-oxo-5-tributylsilyloxypentoxy)carbonylhept-2-enoic acid (PubChem CID 141075945) has the molecular formula C25H46O6Si and a molecular weight of 470.72 g/mol. Its IUPAC name is (E)-3-(5-oxo-5-tributylsilyloxypentoxy)carbonylhept-2-enoic acid.
| Compound Name | (E)-3-(5-oxo-5-tributylsilyloxypentoxy)carbonylhept-2-enoic acid |
|---|---|
| PubChem CID | 141075945 |
| Molecular Formula | C25H46O6Si |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | (E)-3-(5-oxo-5-tributylsilyloxypentoxy)carbonylhept-2-enoic acid |
| SMILES | CCCC/C(=C\C(=O)O)C(=O)OCCCCC(=O)O[Si](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C25H46O6Si/c1-5-9-15-22(21-23(26)27)25(29)30-17-14-13-16-24(28)31-32(18-10-6-2,19-11-7-3)20-12-8-4/h21H,5-20H2,1-4H3,(H,26,27)/b22-21+ |
| InChIKey | ZLFWYWHTVBAJKM-QURGRASLSA-N |
| XLogP | 6.79 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|