C20H21FNO3S+ — CID 10972484
2-[5-[(4-fluorophenyl)methyl]-3,4-dihydro-2H-pyrrol-1-ium-1-yl]-1-(4-methylsulfonylphenyl)ethanone (PubChem CID 10972484) has the molecular formula C20H21FNO3S+ and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-[5-[(4-fluorophenyl)methyl]-3,4-dihydro-2H-pyrrol-1-ium-1-yl]-1-(4-methylsulfonylphenyl)ethanone.
| Compound Name | 2-[5-[(4-fluorophenyl)methyl]-3,4-dihydro-2H-pyrrol-1-ium-1-yl]-1-(4-methylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 10972484 |
| Molecular Formula | C20H21FNO3S+ |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-[5-[(4-fluorophenyl)methyl]-3,4-dihydro-2H-pyrrol-1-ium-1-yl]-1-(4-methylsulfonylphenyl)ethanone |
| SMILES | CS(=O)(=O)c1ccc(C(=O)C[N+]2=C(Cc3ccc(F)cc3)CCC2)cc1 |
| InChI | InChI=1S/C20H21FNO3S/c1-26(24,25)19-10-6-16(7-11-19)20(23)14-22-12-2-3-18(22)13-15-4-8-17(21)9-5-15/h4-11H,2-3,12-14H2,1H3/q+1 |
| InChIKey | ZNLLFJMTVPZBIS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|