C16H18BrNO3S2 — CID 11647343
1-(4-methylsulfonylphenyl)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)ethanone bromide (PubChem CID 11647343) has the molecular formula C16H18BrNO3S2 and a molecular weight of 416.36 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)ethanone bromide.
| Compound Name | 1-(4-methylsulfonylphenyl)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)ethanone bromide |
|---|---|
| PubChem CID | 11647343 |
| Molecular Formula | C16H18BrNO3S2 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)ethanone bromide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)C[n+]2csc3c2CCCC3)cc1.[Br-] |
| InChI | InChI=1S/C16H18NO3S2.BrH/c1-22(19,20)13-8-6-12(7-9-13)15(18)10-17-11-21-16-5-3-2-4-14(16)17;/h6-9,11H,2-5,10H2,1H3;1H/q+1;/p-1 |
| InChIKey | FVVOXYZRFRHIST-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 55.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|