C20H22NO3S+ — CID 10895399
2-(5-benzyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-1-(4-methylsulfonylphenyl)ethanone (PubChem CID 10895399) has the molecular formula C20H22NO3S+ and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-(5-benzyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-1-(4-methylsulfonylphenyl)ethanone.
| Compound Name | 2-(5-benzyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-1-(4-methylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 10895399 |
| Molecular Formula | C20H22NO3S+ |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-(5-benzyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-1-(4-methylsulfonylphenyl)ethanone |
| SMILES | CS(=O)(=O)c1ccc(C(=O)C[N+]2=C(Cc3ccccc3)CCC2)cc1 |
| InChI | InChI=1S/C20H22NO3S/c1-25(23,24)19-11-9-17(10-12-19)20(22)15-21-13-5-8-18(21)14-16-6-3-2-4-7-16/h2-4,6-7,9-12H,5,8,13-15H2,1H3/q+1 |
| InChIKey | SNJLAZDMTDWXSX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|