C27H21N3O3S — CID 10972684
N-(2-aminophenyl)-3-[4-[(4-phenylphenyl)sulfonylamino]phenyl]prop-2-ynamide (PubChem CID 10972684) has the molecular formula C27H21N3O3S and a molecular weight of 467.55 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[4-[(4-phenylphenyl)sulfonylamino]phenyl]prop-2-ynamide.
| Compound Name | N-(2-aminophenyl)-3-[4-[(4-phenylphenyl)sulfonylamino]phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 10972684 |
| Molecular Formula | C27H21N3O3S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N-(2-aminophenyl)-3-[4-[(4-phenylphenyl)sulfonylamino]phenyl]prop-2-ynamide |
| SMILES | Nc1ccccc1NC(=O)C#Cc1ccc(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H21N3O3S/c28-25-8-4-5-9-26(25)29-27(31)19-12-20-10-15-23(16-11-20)30-34(32,33)24-17-13-22(14-18-24)21-6-2-1-3-7-21/h1-11,13-18,30H,28H2,(H,29,31) |
| InChIKey | DMOIWKDIGHSYIE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|