C11H19O3P — CID 10977276
(1R,4S)-2-diethoxyphosphorylbicyclo[2.2.1]hept-2-ene (PubChem CID 10977276) has the molecular formula C11H19O3P and a molecular weight of 230.24 g/mol. Its IUPAC name is (1R,4S)-2-diethoxyphosphorylbicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S)-2-diethoxyphosphorylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 10977276 |
| Molecular Formula | C11H19O3P |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (1R,4S)-2-diethoxyphosphorylbicyclo[2.2.1]hept-2-ene |
| SMILES | CCOP(=O)(OCC)C1=C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C11H19O3P/c1-3-13-15(12,14-4-2)11-8-9-5-6-10(11)7-9/h8-10H,3-7H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | WFPIVRUWNZSPAN-VHSXEESVSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|