C12H18FO3P — CID 10611338
(1S,4S,5Z)-5-[diethoxyphosphoryl(fluoro)methylidene]bicyclo[2.2.1]hept-2-ene (PubChem CID 10611338) has the molecular formula C12H18FO3P and a molecular weight of 260.24 g/mol. Its IUPAC name is (1S,4S,5Z)-5-[diethoxyphosphoryl(fluoro)methylidene]bicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4S,5Z)-5-[diethoxyphosphoryl(fluoro)methylidene]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 10611338 |
| Molecular Formula | C12H18FO3P |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (1S,4S,5Z)-5-[diethoxyphosphoryl(fluoro)methylidene]bicyclo[2.2.1]hept-2-ene |
| SMILES | CCOP(=O)(OCC)/C(F)=C1/C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H18FO3P/c1-3-15-17(14,16-4-2)12(13)11-8-9-5-6-10(11)7-9/h5-6,9-10H,3-4,7-8H2,1-2H3/b12-11-/t9-,10+/m0/s1 |
| InChIKey | HEQQJDPLPVSMPY-FQHHDQPRSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|