C13H19O3P — CID 53475283
(1R,2R,5R,6S)-3-diethoxyphosphoryltricyclo[4.2.1.02,5]nona-3,7-diene (PubChem CID 53475283) has the molecular formula C13H19O3P and a molecular weight of 254.27 g/mol. Its IUPAC name is (1R,2R,5R,6S)-3-diethoxyphosphoryltricyclo[4.2.1.02,5]nona-3,7-diene.
| Compound Name | (1R,2R,5R,6S)-3-diethoxyphosphoryltricyclo[4.2.1.02,5]nona-3,7-diene |
|---|---|
| PubChem CID | 53475283 |
| Molecular Formula | C13H19O3P |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (1R,2R,5R,6S)-3-diethoxyphosphoryltricyclo[4.2.1.02,5]nona-3,7-diene |
| SMILES | CCOP(=O)(OCC)C1=C[C@@H]2[C@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C13H19O3P/c1-3-15-17(14,16-4-2)12-8-11-9-5-6-10(7-9)13(11)12/h5-6,8-11,13H,3-4,7H2,1-2H3/t9-,10+,11+,13-/m1/s1 |
| InChIKey | MXSSFIAUQLZFOH-MPPDQPJWSA-N |
| XLogP | 3.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|