C12H11ClO3 — CID 10977520
(2R,3S)-3-(3-chlorophenyl)-3-hydroxy-2-methyl-2H-pyran-6-one (PubChem CID 10977520) has the molecular formula C12H11ClO3 and a molecular weight of 238.67 g/mol. Its IUPAC name is (2R,3S)-3-(3-chlorophenyl)-3-hydroxy-2-methyl-2H-pyran-6-one.
| Compound Name | (2R,3S)-3-(3-chlorophenyl)-3-hydroxy-2-methyl-2H-pyran-6-one |
|---|---|
| PubChem CID | 10977520 |
| Molecular Formula | C12H11ClO3 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | (2R,3S)-3-(3-chlorophenyl)-3-hydroxy-2-methyl-2H-pyran-6-one |
| SMILES | C[C@H]1OC(=O)C=C[C@]1(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H11ClO3/c1-8-12(15,6-5-11(14)16-8)9-3-2-4-10(13)7-9/h2-8,15H,1H3/t8-,12-/m1/s1 |
| InChIKey | SQBNWFUZLDEOEL-PRHODGIISA-N |
| XLogP | 2.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |