C18H18O4 — CID 10979416
(1S,2R)-1-(furan-2-yl)-3-(naphthalen-2-ylmethoxy)propane-1,2-diol (PubChem CID 10979416) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is (1S,2R)-1-(furan-2-yl)-3-(naphthalen-2-ylmethoxy)propane-1,2-diol.
| Compound Name | (1S,2R)-1-(furan-2-yl)-3-(naphthalen-2-ylmethoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 10979416 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (1S,2R)-1-(furan-2-yl)-3-(naphthalen-2-ylmethoxy)propane-1,2-diol |
| SMILES | O[C@H](COCc1ccc2ccccc2c1)[C@H](O)c1ccco1 |
| InChI | InChI=1S/C18H18O4/c19-16(18(20)17-6-3-9-22-17)12-21-11-13-7-8-14-4-1-2-5-15(14)10-13/h1-10,16,18-20H,11-12H2/t16-,18+/m1/s1 |
| InChIKey | KOPDWWNCVIOTET-AEFFLSMTSA-N |
| XLogP | 3.04 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |