C18H18O5 — CID 11045248
(6S)-2-hydroxy-6-[(1R)-1-hydroxy-2-(naphthalen-2-ylmethoxy)ethyl]-2H-pyran-5-one (PubChem CID 11045248) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is (6S)-2-hydroxy-6-[(1R)-1-hydroxy-2-(naphthalen-2-ylmethoxy)ethyl]-2H-pyran-5-one.
| Compound Name | (6S)-2-hydroxy-6-[(1R)-1-hydroxy-2-(naphthalen-2-ylmethoxy)ethyl]-2H-pyran-5-one |
|---|---|
| PubChem CID | 11045248 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (6S)-2-hydroxy-6-[(1R)-1-hydroxy-2-(naphthalen-2-ylmethoxy)ethyl]-2H-pyran-5-one |
| SMILES | O=C1C=CC(O)O[C@H]1[C@H](O)COCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H18O5/c19-15-7-8-17(21)23-18(15)16(20)11-22-10-12-5-6-13-3-1-2-4-14(13)9-12/h1-9,16-18,20-21H,10-11H2/t16-,17?,18-/m1/s1 |
| InChIKey | BOVIBLRCPUEJJT-GVYDCBATSA-N |
| XLogP | 1.56 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |