C20H18O3 — CID 100966830
(2S,3S)-2-(naphthalen-2-ylmethoxy)-3-phenylmethoxyoxirane (PubChem CID 100966830) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2S,3S)-2-(naphthalen-2-ylmethoxy)-3-phenylmethoxyoxirane.
| Compound Name | (2S,3S)-2-(naphthalen-2-ylmethoxy)-3-phenylmethoxyoxirane |
|---|---|
| PubChem CID | 100966830 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (2S,3S)-2-(naphthalen-2-ylmethoxy)-3-phenylmethoxyoxirane |
| SMILES | c1ccc(CO[C@H]2O[C@@H]2OCc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C20H18O3/c1-2-6-15(7-3-1)13-21-19-20(23-19)22-14-16-10-11-17-8-4-5-9-18(17)12-16/h1-12,19-20H,13-14H2/t19-,20-/m0/s1 |
| InChIKey | BDJYXRIAZGLKCE-PMACEKPBSA-N |
| XLogP | 4.26 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|