C15H16N4O3 — CID 10979495
9-(3-hydroxypropyl)-1-methyl-8-phenyl-3H-purine-2,6-dione (PubChem CID 10979495) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 9-(3-hydroxypropyl)-1-methyl-8-phenyl-3H-purine-2,6-dione.
| Compound Name | 9-(3-hydroxypropyl)-1-methyl-8-phenyl-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 10979495 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 9-(3-hydroxypropyl)-1-methyl-8-phenyl-3H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c2c(nc(-c3ccccc3)n2CCCO)c1=O |
| InChI | InChI=1S/C15H16N4O3/c1-18-14(21)11-13(17-15(18)22)19(8-5-9-20)12(16-11)10-6-3-2-4-7-10/h2-4,6-7,20H,5,8-9H2,1H3,(H,17,22) |
| InChIKey | HRYDMCWOLJHPBP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |