C14H14N4O2 — CID 662013
9-benzyl-1,8-dimethyl-3H-purine-2,6-dione (PubChem CID 662013) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 9-benzyl-1,8-dimethyl-3H-purine-2,6-dione.
| Compound Name | 9-benzyl-1,8-dimethyl-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 662013 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 9-benzyl-1,8-dimethyl-3H-purine-2,6-dione |
| SMILES | Cc1nc2c(=O)n(C)c(=O)[nH]c2n1Cc1ccccc1 |
| InChI | InChI=1S/C14H14N4O2/c1-9-15-11-12(16-14(20)17(2)13(11)19)18(9)8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3,(H,16,20) |
| InChIKey | LFZJGQSDRWRZIR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |