C14H14N5O2+ — CID 91001144
6-benzyl-1,3-dimethyl-8H-pyrimido[5,4-e][1,2,4]triazin-1-ium-5,7-dione (PubChem CID 91001144) has the molecular formula C14H14N5O2+ and a molecular weight of 284.30 g/mol. Its IUPAC name is 6-benzyl-1,3-dimethyl-8H-pyrimido[5,4-e][1,2,4]triazin-1-ium-5,7-dione.
| Compound Name | 6-benzyl-1,3-dimethyl-8H-pyrimido[5,4-e][1,2,4]triazin-1-ium-5,7-dione |
|---|---|
| PubChem CID | 91001144 |
| Molecular Formula | C14H14N5O2+ |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 6-benzyl-1,3-dimethyl-8H-pyrimido[5,4-e][1,2,4]triazin-1-ium-5,7-dione |
| SMILES | Cc1nc2c(=O)n(Cc3ccccc3)c(=O)[nH]c2[n+](C)n1 |
| InChI | InChI=1S/C14H13N5O2/c1-9-15-11-12(18(2)17-9)16-14(21)19(13(11)20)8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3/p+1 |
| InChIKey | WQCOOVMGGLOWFP-UHFFFAOYSA-O |
| XLogP | -0.34 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|