C18H24O3S — CID 10980154
ethyl 4-(1-methyl-2-oxocyclopentyl)-4-phenylsulfanylbutanoate (PubChem CID 10980154) has the molecular formula C18H24O3S and a molecular weight of 320.45 g/mol. Its IUPAC name is ethyl 4-(1-methyl-2-oxocyclopentyl)-4-phenylsulfanylbutanoate.
| Compound Name | ethyl 4-(1-methyl-2-oxocyclopentyl)-4-phenylsulfanylbutanoate |
|---|---|
| PubChem CID | 10980154 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | ethyl 4-(1-methyl-2-oxocyclopentyl)-4-phenylsulfanylbutanoate |
| SMILES | CCOC(=O)CCC(Sc1ccccc1)C1(C)CCCC1=O |
| InChI | InChI=1S/C18H24O3S/c1-3-21-17(20)12-11-16(18(2)13-7-10-15(18)19)22-14-8-5-4-6-9-14/h4-6,8-9,16H,3,7,10-13H2,1-2H3 |
| InChIKey | MUCOYDFMIHTCDD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |