C18H34O3Si — CID 10980334
6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutyl]-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 10980334) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is 6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutyl]-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutyl]-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10980334 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutyl]-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | C[C@@H](CC(O)C1C(=O)C=CCC1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O3Si/c1-13(21-22(7,8)17(2,3)4)12-15(20)16-14(19)10-9-11-18(16,5)6/h9-10,13,15-16,20H,11-12H2,1-8H3/t13-,15?,16?/m0/s1 |
| InChIKey | XLNUYOHDLJSRDX-JEYLPNPQSA-N |
| XLogP | 4.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|