C18H24N2O2 — CID 10980623
[(3S)-3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-methylcarbamate (PubChem CID 10980623) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is [(3S)-3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-methylcarbamate.
| Compound Name | [(3S)-3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-methylcarbamate |
|---|---|
| PubChem CID | 10980623 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | [(3S)-3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-methylcarbamate |
| SMILES | C#CCN[C@H]1CCc2ccc(OC(=O)N(C)CCCC)cc21 |
| InChI | InChI=1S/C18H24N2O2/c1-4-6-12-20(3)18(21)22-15-9-7-14-8-10-17(16(14)13-15)19-11-5-2/h2,7,9,13,17,19H,4,6,8,10-12H2,1,3H3/t17-/m0/s1 |
| InChIKey | PBBZQCRCUHDOBK-KRWDZBQOSA-N |
| XLogP | 3.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|