C16H24N2O3 — CID 143532702
[3-(propylamino)-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-(hydroxymethyl)carbamate (PubChem CID 143532702) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is [3-(propylamino)-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-(hydroxymethyl)carbamate.
| Compound Name | [3-(propylamino)-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-(hydroxymethyl)carbamate |
|---|---|
| PubChem CID | 143532702 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [3-(propylamino)-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-(hydroxymethyl)carbamate |
| SMILES | CCCNC1CCc2ccc(OC(=O)N(CC)CO)cc21 |
| InChI | InChI=1S/C16H24N2O3/c1-3-9-17-15-8-6-12-5-7-13(10-14(12)15)21-16(20)18(4-2)11-19/h5,7,10,15,17,19H,3-4,6,8-9,11H2,1-2H3 |
| InChIKey | GVHNZOYHTOZSEH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|