C15H15BrF2Si — CID 10980755
[4-(4-bromophenyl)-2,3-difluorophenyl]-trimethylsilane (PubChem CID 10980755) has the molecular formula C15H15BrF2Si and a molecular weight of 341.27 g/mol. Its IUPAC name is [4-(4-bromophenyl)-2,3-difluorophenyl]-trimethylsilane.
| Compound Name | [4-(4-bromophenyl)-2,3-difluorophenyl]-trimethylsilane |
|---|---|
| PubChem CID | 10980755 |
| Molecular Formula | C15H15BrF2Si |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | [4-(4-bromophenyl)-2,3-difluorophenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(Br)cc2)c(F)c1F |
| InChI | InChI=1S/C15H15BrF2Si/c1-19(2,3)13-9-8-12(14(17)15(13)18)10-4-6-11(16)7-5-10/h4-9H,1-3H3 |
| InChIKey | FYDFNIWQYPRKAF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|