C20H18N2O4 — CID 10981008
3-(3-oxo-1H-isoindol-2-yl)-1-phenylmethoxypiperidine-2,6-dione (PubChem CID 10981008) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 3-(3-oxo-1H-isoindol-2-yl)-1-phenylmethoxypiperidine-2,6-dione.
| Compound Name | 3-(3-oxo-1H-isoindol-2-yl)-1-phenylmethoxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 10981008 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3-(3-oxo-1H-isoindol-2-yl)-1-phenylmethoxypiperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccccc3C2=O)C(=O)N1OCc1ccccc1 |
| InChI | InChI=1S/C20H18N2O4/c23-18-11-10-17(21-12-15-8-4-5-9-16(15)19(21)24)20(25)22(18)26-13-14-6-2-1-3-7-14/h1-9,17H,10-13H2 |
| InChIKey | SEKGQAVVHJCKFY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|