C21H20N2O3S — CID 164762943
3-(7-benzylsulfanyl-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione (PubChem CID 164762943) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-(7-benzylsulfanyl-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione.
| Compound Name | 3-(7-benzylsulfanyl-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 164762943 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3-(7-benzylsulfanyl-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione |
| SMILES | CN1C(=O)CCC(N2Cc3c(SCc4ccccc4)cccc3C2=O)C1=O |
| InChI | InChI=1S/C21H20N2O3S/c1-22-19(24)11-10-17(21(22)26)23-12-16-15(20(23)25)8-5-9-18(16)27-13-14-6-3-2-4-7-14/h2-9,17H,10-13H2,1H3 |
| InChIKey | WEQLOLGHQAELOM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|