C20H18N2O5 — CID 118435253
2-(2,6-dioxo-1-phenylmethoxypiperidin-3-yl)-3,3a-dihydroisoindole-1,4-dione (PubChem CID 118435253) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-(2,6-dioxo-1-phenylmethoxypiperidin-3-yl)-3,3a-dihydroisoindole-1,4-dione.
| Compound Name | 2-(2,6-dioxo-1-phenylmethoxypiperidin-3-yl)-3,3a-dihydroisoindole-1,4-dione |
|---|---|
| PubChem CID | 118435253 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-(2,6-dioxo-1-phenylmethoxypiperidin-3-yl)-3,3a-dihydroisoindole-1,4-dione |
| SMILES | O=C1C=CC=C2C(=O)N(C3CCC(=O)N(OCc4ccccc4)C3=O)CC12 |
| InChI | InChI=1S/C20H18N2O5/c23-17-8-4-7-14-15(17)11-21(19(14)25)16-9-10-18(24)22(20(16)26)27-12-13-5-2-1-3-6-13/h1-8,15-16H,9-12H2 |
| InChIKey | WMQLRMLLEDWUSW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|