C18H21N3O6 — CID 134374765
(2,5-dioxopyrrolidin-1-yl) (2S,5R)-7-hydroxy-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 134374765) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S,5R)-7-hydroxy-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S,5R)-7-hydroxy-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 134374765 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S,5R)-7-hydroxy-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)[C@@H]1CC[C@@H]2CN1C(O)N2OCc1ccccc1 |
| InChI | InChI=1S/C18H21N3O6/c22-15-8-9-16(23)21(15)27-17(24)14-7-6-13-10-19(14)18(25)20(13)26-11-12-4-2-1-3-5-12/h1-5,13-14,18,25H,6-11H2/t13-,14+,18?/m1/s1 |
| InChIKey | VENPVWQTMURFFM-RMAOKOMNSA-N |
| XLogP | 0.15 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|