C18H28N4O2 — CID 67571689
1-phenylmethoxy-5-(1,4,7-triazonan-1-ylmethyl)pyrrolidin-2-one (PubChem CID 67571689) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-phenylmethoxy-5-(1,4,7-triazonan-1-ylmethyl)pyrrolidin-2-one.
| Compound Name | 1-phenylmethoxy-5-(1,4,7-triazonan-1-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 67571689 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-phenylmethoxy-5-(1,4,7-triazonan-1-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CCC(CN2CCNCCNCC2)N1OCc1ccccc1 |
| InChI | InChI=1S/C18H28N4O2/c23-18-7-6-17(14-21-12-10-19-8-9-20-11-13-21)22(18)24-15-16-4-2-1-3-5-16/h1-5,17,19-20H,6-15H2 |
| InChIKey | YWXUMAVJLHZLDN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |