C16H21NO3S2 — CID 102136144
5-(2-methoxy-1,3-dithian-2-yl)-1-phenylmethoxypyrrolidin-2-one (PubChem CID 102136144) has the molecular formula C16H21NO3S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 5-(2-methoxy-1,3-dithian-2-yl)-1-phenylmethoxypyrrolidin-2-one.
| Compound Name | 5-(2-methoxy-1,3-dithian-2-yl)-1-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 102136144 |
| Molecular Formula | C16H21NO3S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 5-(2-methoxy-1,3-dithian-2-yl)-1-phenylmethoxypyrrolidin-2-one |
| SMILES | COC1(C2CCC(=O)N2OCc2ccccc2)SCCCS1 |
| InChI | InChI=1S/C16H21NO3S2/c1-19-16(21-10-5-11-22-16)14-8-9-15(18)17(14)20-12-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3 |
| InChIKey | WLJFRIRYKKUVNR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |