C20H27N3O5 — CID 10982006
tert-butyl N-[2-(4-methoxyphenyl)-1,3-dioxo-4,4a,5,6,7,8-hexahydropyrido[1,2-c]pyrimidin-5-yl]carbamate (PubChem CID 10982006) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is tert-butyl N-[2-(4-methoxyphenyl)-1,3-dioxo-4,4a,5,6,7,8-hexahydropyrido[1,2-c]pyrimidin-5-yl]carbamate.
| Compound Name | tert-butyl N-[2-(4-methoxyphenyl)-1,3-dioxo-4,4a,5,6,7,8-hexahydropyrido[1,2-c]pyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 10982006 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | tert-butyl N-[2-(4-methoxyphenyl)-1,3-dioxo-4,4a,5,6,7,8-hexahydropyrido[1,2-c]pyrimidin-5-yl]carbamate |
| SMILES | COc1ccc(N2C(=O)CC3C(NC(=O)OC(C)(C)C)CCCN3C2=O)cc1 |
| InChI | InChI=1S/C20H27N3O5/c1-20(2,3)28-18(25)21-15-6-5-11-22-16(15)12-17(24)23(19(22)26)13-7-9-14(27-4)10-8-13/h7-10,15-16H,5-6,11-12H2,1-4H3,(H,21,25) |
| InChIKey | HFHNLZKRKHTICI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |