C26H40O4 — CID 10982621
[(2R,3S)-3-[(1S,2R,5S,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-1-oxobutan-2-yl] acetate (PubChem CID 10982621) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is [(2R,3S)-3-[(1S,2R,5S,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-1-oxobutan-2-yl] acetate.
| Compound Name | [(2R,3S)-3-[(1S,2R,5S,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-1-oxobutan-2-yl] acetate |
|---|---|
| PubChem CID | 10982621 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [(2R,3S)-3-[(1S,2R,5S,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-1-oxobutan-2-yl] acetate |
| SMILES | CO[C@@H]1C[C@H]2[C@@H]3CC[C@H]([C@H](C)[C@H](C=O)OC(C)=O)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@H]3C[C@]312 |
| InChI | InChI=1S/C26H40O4/c1-15(22(14-27)30-16(2)28)19-6-7-20-18-12-23(29-5)26-13-17(26)8-11-25(26,4)21(18)9-10-24(19,20)3/h14-15,17-23H,6-13H2,1-5H3/t15-,17-,18-,19+,20-,21-,22-,23+,24+,25+,26-/m0/s1 |
| InChIKey | YWLFJOKOCNDGGB-ASWCRAMGSA-N |
| XLogP | 5.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|