C33H52O5 — CID 25088511
[(2S,3S,4S)-4-acetyloxy-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-6-methyl-5-methylideneheptan-3-yl] acetate (PubChem CID 25088511) has the molecular formula C33H52O5 and a molecular weight of 528.77 g/mol. Its IUPAC name is [(2S,3S,4S)-4-acetyloxy-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-6-methyl-5-methylideneheptan-3-yl] acetate.
| Compound Name | [(2S,3S,4S)-4-acetyloxy-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-6-methyl-5-methylideneheptan-3-yl] acetate |
|---|---|
| PubChem CID | 25088511 |
| Molecular Formula | C33H52O5 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | [(2S,3S,4S)-4-acetyloxy-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-6-methyl-5-methylideneheptan-3-yl] acetate |
| SMILES | C=C(C(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](OC)[C@]45C[C@H]4CC[C@]5(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H52O5/c1-18(2)19(3)29(37-21(5)34)30(38-22(6)35)20(4)25-10-11-26-24-16-28(36-9)33-17-23(33)12-15-32(33,8)27(24)13-14-31(25,26)7/h18,20,23-30H,3,10-17H2,1-2,4-9H3/t20-,23+,24-,25+,26-,27-,28+,29-,30-,31+,32+,33-/m0/s1 |
| InChIKey | CEFNJVMLPNTVKX-NGHRHECJSA-N |
| XLogP | 6.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|