C30H46O4 — CID 10983562
(1R,4S,5S,10R,11S,14S,15R,16S,18R,23R)-4,10,11,15,18,21,21-heptamethyl-9,25-dioxahexacyclo[14.7.2.01,15.04,14.05,11.018,23]pentacosane-8,24-dione (PubChem CID 10983562) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is (1R,4S,5S,10R,11S,14S,15R,16S,18R,23R)-4,10,11,15,18,21,21-heptamethyl-9,25-dioxahexacyclo[14.7.2.01,15.04,14.05,11.018,23]pentacosane-8,24-dione.
| Compound Name | (1R,4S,5S,10R,11S,14S,15R,16S,18R,23R)-4,10,11,15,18,21,21-heptamethyl-9,25-dioxahexacyclo[14.7.2.01,15.04,14.05,11.018,23]pentacosane-8,24-dione |
|---|---|
| PubChem CID | 10983562 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (1R,4S,5S,10R,11S,14S,15R,16S,18R,23R)-4,10,11,15,18,21,21-heptamethyl-9,25-dioxahexacyclo[14.7.2.01,15.04,14.05,11.018,23]pentacosane-8,24-dione |
| SMILES | C[C@H]1OC(=O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@@]2(C)CC[C@@]23C(=O)O[C@@H](C[C@@]4(C)CCC(C)(C)C[C@H]42)[C@]13C |
| InChI | InChI=1S/C30H46O4/c1-18-27(5)11-10-20-28(6,19(27)8-9-23(31)33-18)14-15-30-21-16-25(2,3)12-13-26(21,4)17-22(29(20,30)7)34-24(30)32/h18-22H,8-17H2,1-7H3/t18-,19-,20+,21-,22+,26-,27-,28+,29+,30+/m1/s1 |
| InChIKey | LJIUPTVICXZWPH-NHAFCUDWSA-N |
| XLogP | 6.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |