C29H46O2 — CID 163053651
(4aS,6aS,6aR,6bS,8aR,12aR,14aS,14bR)-2,2,6a,6a,8a,14a-hexamethyl-10-oxo-3,4,5,6,6b,7,8,9,11,12,12a,13,14,14b-tetradecahydro-1H-picene-4a-carbaldehyde (PubChem CID 163053651) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is (4aS,6aS,6aR,6bS,8aR,12aR,14aS,14bR)-2,2,6a,6a,8a,14a-hexamethyl-10-oxo-3,4,5,6,6b,7,8,9,11,12,12a,13,14,14b-tetradecahydro-1H-picene-4a-carbaldehyde.
| Compound Name | (4aS,6aS,6aR,6bS,8aR,12aR,14aS,14bR)-2,2,6a,6a,8a,14a-hexamethyl-10-oxo-3,4,5,6,6b,7,8,9,11,12,12a,13,14,14b-tetradecahydro-1H-picene-4a-carbaldehyde |
|---|---|
| PubChem CID | 163053651 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | (4aS,6aS,6aR,6bS,8aR,12aR,14aS,14bR)-2,2,6a,6a,8a,14a-hexamethyl-10-oxo-3,4,5,6,6b,7,8,9,11,12,12a,13,14,14b-tetradecahydro-1H-picene-4a-carbaldehyde |
| SMILES | CC1(C)CC[C@]2(C=O)CC[C@]3(C)[C@H]4CC[C@]5(C)CC(=O)CC[C@H]5[C@]4(C)CC[C@@]3(C)[C@H]2C1 |
| InChI | InChI=1S/C29H46O2/c1-24(2)11-15-29(19-30)16-14-27(5)22-9-10-25(3)17-20(31)7-8-21(25)26(22,4)12-13-28(27,6)23(29)18-24/h19,21-23H,7-18H2,1-6H3/t21-,22+,23-,25-,26+,27-,28+,29-/m1/s1 |
| InChIKey | YZVCEBRTKZFQBW-VQYJYDOLSA-N |
| XLogP | 7.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|