C30H48O3 — CID 163067318
(4aR,6aR,6aR,6bR,8aS,9R,10S,12aR,14aS,14bR)-10-hydroxy-2,2,4a,6a,8a,9,14a-heptamethyl-6-oxo-3,4,5,6b,7,8,9,10,11,12,12a,13,14,14b-tetradecahydro-1H-picene-6a-carbaldehyde (PubChem CID 163067318) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is (4aR,6aR,6aR,6bR,8aS,9R,10S,12aR,14aS,14bR)-10-hydroxy-2,2,4a,6a,8a,9,14a-heptamethyl-6-oxo-3,4,5,6b,7,8,9,10,11,12,12a,13,14,14b-tetradecahydro-1H-picene-6a-carbaldehyde.
| Compound Name | (4aR,6aR,6aR,6bR,8aS,9R,10S,12aR,14aS,14bR)-10-hydroxy-2,2,4a,6a,8a,9,14a-heptamethyl-6-oxo-3,4,5,6b,7,8,9,10,11,12,12a,13,14,14b-tetradecahydro-1H-picene-6a-carbaldehyde |
|---|---|
| PubChem CID | 163067318 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | (4aR,6aR,6aR,6bR,8aS,9R,10S,12aR,14aS,14bR)-10-hydroxy-2,2,4a,6a,8a,9,14a-heptamethyl-6-oxo-3,4,5,6b,7,8,9,10,11,12,12a,13,14,14b-tetradecahydro-1H-picene-6a-carbaldehyde |
| SMILES | C[C@H]1[C@@H](O)CC[C@@H]2[C@]1(C)CC[C@@H]1[C@@]2(C=O)CC[C@@]2(C)[C@@H]3CC(C)(C)CC[C@]3(C)CC(=O)[C@]12C |
| InChI | InChI=1S/C30H48O3/c1-19-20(32)8-9-21-27(19,5)11-10-22-29(7)24(33)17-26(4)13-12-25(2,3)16-23(26)28(29,6)14-15-30(21,22)18-31/h18-23,32H,8-17H2,1-7H3/t19-,20-,21+,22-,23+,26+,27+,28-,29-,30+/m0/s1 |
| InChIKey | IRQRKWNUTYWIJR-WSGBSSCDSA-N |
| XLogP | 6.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|