C34H25NO4S — CID 10984420
N-[(1,1-dioxo-3,4-diphenyl-2,1lambda6-benzoxathiin-7-yl)-phenylmethyl]benzamide (PubChem CID 10984420) has the molecular formula C34H25NO4S and a molecular weight of 543.64 g/mol. Its IUPAC name is N-[(1,1-dioxo-3,4-diphenyl-2,1lambda6-benzoxathiin-7-yl)-phenylmethyl]benzamide.
| Compound Name | N-[(1,1-dioxo-3,4-diphenyl-2,1lambda6-benzoxathiin-7-yl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 10984420 |
| Molecular Formula | C34H25NO4S |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | N-[(1,1-dioxo-3,4-diphenyl-2,1lambda6-benzoxathiin-7-yl)-phenylmethyl]benzamide |
| SMILES | O=C(NC(c1ccccc1)c1ccc2c(c1)S(=O)(=O)OC(c1ccccc1)=C2c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H25NO4S/c36-34(27-19-11-4-12-20-27)35-32(25-15-7-2-8-16-25)28-21-22-29-30(23-28)40(37,38)39-33(26-17-9-3-10-18-26)31(29)24-13-5-1-6-14-24/h1-23,32H,(H,35,36) |
| InChIKey | BUSZTMUUOWIMIR-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|