C30H26N2O3S — CID 28592242
N-benzhydryl-1-ethyl-2,2-dioxo-4-phenyl-2λ6,1-benzothiazine-3-carboxamide (PubChem CID 28592242) has the molecular formula C30H26N2O3S and a molecular weight of 494.62 g/mol. Its IUPAC name is N-benzhydryl-1-ethyl-2,2-dioxo-4-phenyl-2λ6,1-benzothiazine-3-carboxamide.
| Compound Name | N-benzhydryl-1-ethyl-2,2-dioxo-4-phenyl-2λ6,1-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 28592242 |
| Molecular Formula | C30H26N2O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | N-benzhydryl-1-ethyl-2,2-dioxo-4-phenyl-2λ6,1-benzothiazine-3-carboxamide |
| SMILES | CCN1c2ccccc2C(c2ccccc2)=C(C(=O)NC(c2ccccc2)c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C30H26N2O3S/c1-2-32-26-21-13-12-20-25(26)27(22-14-6-3-7-15-22)29(36(32,34)35)30(33)31-28(23-16-8-4-9-17-23)24-18-10-5-11-19-24/h3-21,28H,2H2,1H3,(H,31,33) |
| InChIKey | SWAFLQNSHXZLNY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |