C30H27N4O2+ — CID 142255119
1-benzhydryl-3-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-4-ium-3-yl)urea (PubChem CID 142255119) has the molecular formula C30H27N4O2+ and a molecular weight of 475.57 g/mol. Its IUPAC name is 1-benzhydryl-3-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-4-ium-3-yl)urea.
| Compound Name | 1-benzhydryl-3-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-4-ium-3-yl)urea |
|---|---|
| PubChem CID | 142255119 |
| Molecular Formula | C30H27N4O2+ |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 1-benzhydryl-3-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-4-ium-3-yl)urea |
| SMILES | CN1C(=O)C(NC(=O)NC(c2ccccc2)c2ccccc2)[NH+]=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C30H26N4O2/c1-34-25-20-12-11-19-24(25)27(23-17-9-4-10-18-23)31-28(29(34)35)33-30(36)32-26(21-13-5-2-6-14-21)22-15-7-3-8-16-22/h2-20,26,28H,1H3,(H2,32,33,36)/p+1 |
| InChIKey | MPPGHAMWHWBQKO-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |