C25H24ClN4O2S+ — CID 142255240
1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-4-ium-3-yl)-3-[2-(4-hydroxyphenyl)ethyl]thiourea (PubChem CID 142255240) has the molecular formula C25H24ClN4O2S+ and a molecular weight of 480.01 g/mol. Its IUPAC name is 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-4-ium-3-yl)-3-[2-(4-hydroxyphenyl)ethyl]thiourea.
| Compound Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-4-ium-3-yl)-3-[2-(4-hydroxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 142255240 |
| Molecular Formula | C25H24ClN4O2S+ |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-4-ium-3-yl)-3-[2-(4-hydroxyphenyl)ethyl]thiourea |
| SMILES | CN1C(=O)C(NC(=S)NCCc2ccc(O)cc2)[NH+]=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C25H23ClN4O2S/c1-30-21-12-9-18(26)15-20(21)22(17-5-3-2-4-6-17)28-23(24(30)32)29-25(33)27-14-13-16-7-10-19(31)11-8-16/h2-12,15,23,31H,13-14H2,1H3,(H2,27,29,33)/p+1 |
| InChIKey | VZJKIJDFNOPKKL-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 78.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|